C22H20N4O6S — CID 167828554
N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]-2-ethyl-1,3-benzoxazole-5-sulfonamide (PubChem CID 167828554) has the molecular formula C22H20N4O6S and a molecular weight of 468.49 g/mol. Its IUPAC name is N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]-2-ethyl-1,3-benzoxazole-5-sulfonamide.
| Compound Name | N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]-2-ethyl-1,3-benzoxazole-5-sulfonamide |
|---|---|
| PubChem CID | 167828554 |
| Molecular Formula | C22H20N4O6S |
| Molecular Weight | 468.49 g/mol |
| Exact Mass | 468.11 |
| IUPAC Name | N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]-2-ethyl-1,3-benzoxazole-5-sulfonamide |
| SMILES | CCc1nc2cc(S(=O)(=O)Nc3cccc4c3CN(C3CCC(=O)NC3=O)C4=O)ccc2o1 |
| InChI | InChI=1S/C22H20N4O6S/c1-2-20-23-16-10-12(6-8-18(16)32-20)33(30,31)25-15-5-3-4-13-14(15)11-26(22(13)29)17-7-9-19(27)24-21(17)28/h3-6,8,10,17,25H,2,7,9,11H2,1H3,(H,24,27,28) |
| InChIKey | RTMKJUQRVRHFGF-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 138.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.49 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|