C11H10ClNO4S — CID 16642602
4-methyl-3-(1,1,3-trioxo-1,2-thiazolidin-2-yl)benzoyl chloride (PubChem CID 16642602) has the molecular formula C11H10ClNO4S and a molecular weight of 287.72 g/mol. Its IUPAC name is 4-methyl-3-(1,1,3-trioxo-1,2-thiazolidin-2-yl)benzoyl chloride.
| Compound Name | 4-methyl-3-(1,1,3-trioxo-1,2-thiazolidin-2-yl)benzoyl chloride |
|---|---|
| PubChem CID | 16642602 |
| Molecular Formula | C11H10ClNO4S |
| Molecular Weight | 287.72 g/mol |
| Exact Mass | 287.00 |
| IUPAC Name | 4-methyl-3-(1,1,3-trioxo-1,2-thiazolidin-2-yl)benzoyl chloride |
| SMILES | Cc1ccc(C(=O)Cl)cc1N1C(=O)CCS1(=O)=O |
| InChI | InChI=1S/C11H10ClNO4S/c1-7-2-3-8(11(12)15)6-9(7)13-10(14)4-5-18(13,16)17/h2-3,6H,4-5H2,1H3 |
| InChIKey | IBVOETMWIKJVJU-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.72 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|