C15H16ClFN2O2 — CID 166428062
N-[4-(1,3-benzoxazol-2-yl)cyclohexyl]-2-chloro-2-fluoroacetamide (PubChem CID 166428062) has the molecular formula C15H16ClFN2O2 and a molecular weight of 310.76 g/mol. Its IUPAC name is N-[4-(1,3-benzoxazol-2-yl)cyclohexyl]-2-chloro-2-fluoroacetamide.
| Compound Name | N-[4-(1,3-benzoxazol-2-yl)cyclohexyl]-2-chloro-2-fluoroacetamide |
|---|---|
| PubChem CID | 166428062 |
| Molecular Formula | C15H16ClFN2O2 |
| Molecular Weight | 310.76 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | N-[4-(1,3-benzoxazol-2-yl)cyclohexyl]-2-chloro-2-fluoroacetamide |
| SMILES | O=C(NC1CCC(c2nc3ccccc3o2)CC1)C(F)Cl |
| InChI | InChI=1S/C15H16ClFN2O2/c16-13(17)14(20)18-10-7-5-9(6-8-10)15-19-11-3-1-2-4-12(11)21-15/h1-4,9-10,13H,5-8H2,(H,18,20) |
| InChIKey | PPZAQHCJBBBNKC-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.76 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|