C21H21NO2 — CID 166429192
(2R,3S)-3-methyl-N-(15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenylmethyl)oxirane-2-carboxamide (PubChem CID 166429192) has the molecular formula C21H21NO2 and a molecular weight of 319.40 g/mol. Its IUPAC name is (2R,3S)-3-methyl-N-(15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenylmethyl)oxirane-2-carboxamide.
| Compound Name | (2R,3S)-3-methyl-N-(15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenylmethyl)oxirane-2-carboxamide |
|---|---|
| PubChem CID | 166429192 |
| Molecular Formula | C21H21NO2 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | (2R,3S)-3-methyl-N-(15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenylmethyl)oxirane-2-carboxamide |
| SMILES | C[C@@H]1O[C@H]1C(=O)NCC1CC2c3ccccc3C1c1ccccc12 |
| InChI | InChI=1S/C21H21NO2/c1-12-20(24-12)21(23)22-11-13-10-18-14-6-2-4-8-16(14)19(13)17-9-5-3-7-15(17)18/h2-9,12-13,18-20H,10-11H2,1H3,(H,22,23)/t12-,13?,18?,19?,20+/m0/s1 |
| InChIKey | MPDDMONNJWJJHC-ZXKGWONLSA-N |
| XLogP | 3.19 |
| TPSA | 41.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|