C24H25NO — CID 30804930
(1R)-N-[[(15S)-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl]methyl]cyclohex-3-ene-1-carboxamide (PubChem CID 30804930) has the molecular formula C24H25NO and a molecular weight of 343.47 g/mol. Its IUPAC name is (1R)-N-[[(15S)-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl]methyl]cyclohex-3-ene-1-carboxamide.
| Compound Name | (1R)-N-[[(15S)-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl]methyl]cyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 30804930 |
| Molecular Formula | C24H25NO |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | (1R)-N-[[(15S)-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl]methyl]cyclohex-3-ene-1-carboxamide |
| SMILES | O=C(NC[C@H]1CC2c3ccccc3C1c1ccccc12)[C@H]1CC=CCC1 |
| InChI | InChI=1S/C24H25NO/c26-24(16-8-2-1-3-9-16)25-15-17-14-22-18-10-4-6-12-20(18)23(17)21-13-7-5-11-19(21)22/h1-2,4-7,10-13,16-17,22-23H,3,8-9,14-15H2,(H,25,26)/t16-,17+,22?,23?/m0/s1 |
| InChIKey | LSNFVEYRUDPOIN-IYXGRNATSA-N |
| XLogP | 4.76 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|