C21H17Cl2N5S — CID 166429491
3-[2-(3-but-3-ynyldiazirin-3-yl)ethylsulfanyl]-5-(2,4-dichlorophenyl)-4-phenyl-1,2,4-triazole (PubChem CID 166429491) has the molecular formula C21H17Cl2N5S and a molecular weight of 442.38 g/mol. Its IUPAC name is 3-[2-(3-but-3-ynyldiazirin-3-yl)ethylsulfanyl]-5-(2,4-dichlorophenyl)-4-phenyl-1,2,4-triazole.
| Compound Name | 3-[2-(3-but-3-ynyldiazirin-3-yl)ethylsulfanyl]-5-(2,4-dichlorophenyl)-4-phenyl-1,2,4-triazole |
|---|---|
| PubChem CID | 166429491 |
| Molecular Formula | C21H17Cl2N5S |
| Molecular Weight | 442.38 g/mol |
| Exact Mass | 441.06 |
| IUPAC Name | 3-[2-(3-but-3-ynyldiazirin-3-yl)ethylsulfanyl]-5-(2,4-dichlorophenyl)-4-phenyl-1,2,4-triazole |
| SMILES | C#CCCC1(CCSc2nnc(-c3ccc(Cl)cc3Cl)n2-c2ccccc2)N=N1 |
| InChI | InChI=1S/C21H17Cl2N5S/c1-2-3-11-21(26-27-21)12-13-29-20-25-24-19(17-10-9-15(22)14-18(17)23)28(20)16-7-5-4-6-8-16/h1,4-10,14H,3,11-13H2 |
| InChIKey | UXNRXYLUZNKUDD-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 55.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.38 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|