C26H23N5O5S — CID 166430256
benzyl N-[[4-[(3-cyano-4-methyl-1H-indol-7-yl)sulfamoyl]benzoyl]-methylamino]carbamate (PubChem CID 166430256) has the molecular formula C26H23N5O5S and a molecular weight of 517.57 g/mol. Its IUPAC name is benzyl N-[[4-[(3-cyano-4-methyl-1H-indol-7-yl)sulfamoyl]benzoyl]-methylamino]carbamate.
| Compound Name | benzyl N-[[4-[(3-cyano-4-methyl-1H-indol-7-yl)sulfamoyl]benzoyl]-methylamino]carbamate |
|---|---|
| PubChem CID | 166430256 |
| Molecular Formula | C26H23N5O5S |
| Molecular Weight | 517.57 g/mol |
| Exact Mass | 517.14 |
| IUPAC Name | benzyl N-[[4-[(3-cyano-4-methyl-1H-indol-7-yl)sulfamoyl]benzoyl]-methylamino]carbamate |
| SMILES | Cc1ccc(NS(=O)(=O)c2ccc(C(=O)N(C)NC(=O)OCc3ccccc3)cc2)c2[nH]cc(C#N)c12 |
| InChI | InChI=1S/C26H23N5O5S/c1-17-8-13-22(24-23(17)20(14-27)15-28-24)30-37(34,35)21-11-9-19(10-12-21)25(32)31(2)29-26(33)36-16-18-6-4-3-5-7-18/h3-13,15,28,30H,16H2,1-2H3,(H,29,33) |
| InChIKey | OIOBSXOWCKNYPI-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 144.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.57 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|