C28H19ClFN3O5S2 — CID 166430895
N-[3-[bis(benzenesulfonyl)amino]-4-fluorophenyl]-2-chloroquinoline-3-carboxamide (PubChem CID 166430895) has the molecular formula C28H19ClFN3O5S2 and a molecular weight of 596.06 g/mol. Its IUPAC name is N-[3-[bis(benzenesulfonyl)amino]-4-fluorophenyl]-2-chloroquinoline-3-carboxamide.
| Compound Name | N-[3-[bis(benzenesulfonyl)amino]-4-fluorophenyl]-2-chloroquinoline-3-carboxamide |
|---|---|
| PubChem CID | 166430895 |
| Molecular Formula | C28H19ClFN3O5S2 |
| Molecular Weight | 596.06 g/mol |
| Exact Mass | 595.04 |
| IUPAC Name | N-[3-[bis(benzenesulfonyl)amino]-4-fluorophenyl]-2-chloroquinoline-3-carboxamide |
| SMILES | O=C(Nc1ccc(F)c(N(S(=O)(=O)c2ccccc2)S(=O)(=O)c2ccccc2)c1)c1cc2ccccc2nc1Cl |
| InChI | InChI=1S/C28H19ClFN3O5S2/c29-27-23(17-19-9-7-8-14-25(19)32-27)28(34)31-20-15-16-24(30)26(18-20)33(39(35,36)21-10-3-1-4-11-21)40(37,38)22-12-5-2-6-13-22/h1-18H,(H,31,34) |
| InChIKey | ZLYRRHGJZDPRIB-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 113.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.06 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|