C16H18ClFN2O3 — CID 166430950
2-chloro-2-fluoro-1-[2-(piperidine-1-carbonyl)-2,3-dihydro-1,4-benzoxazin-4-yl]ethanone (PubChem CID 166430950) has the molecular formula C16H18ClFN2O3 and a molecular weight of 340.78 g/mol. Its IUPAC name is 2-chloro-2-fluoro-1-[2-(piperidine-1-carbonyl)-2,3-dihydro-1,4-benzoxazin-4-yl]ethanone.
| Compound Name | 2-chloro-2-fluoro-1-[2-(piperidine-1-carbonyl)-2,3-dihydro-1,4-benzoxazin-4-yl]ethanone |
|---|---|
| PubChem CID | 166430950 |
| Molecular Formula | C16H18ClFN2O3 |
| Molecular Weight | 340.78 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | 2-chloro-2-fluoro-1-[2-(piperidine-1-carbonyl)-2,3-dihydro-1,4-benzoxazin-4-yl]ethanone |
| SMILES | O=C(C1CN(C(=O)C(F)Cl)c2ccccc2O1)N1CCCCC1 |
| InChI | InChI=1S/C16H18ClFN2O3/c17-14(18)16(22)20-10-13(15(21)19-8-4-1-5-9-19)23-12-7-3-2-6-11(12)20/h2-3,6-7,13-14H,1,4-5,8-10H2 |
| InChIKey | NOLAACMFHDTRDY-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.78 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|