C24H28N2O3S — CID 8944893
piperidin-1-yl-[(2R)-4-(5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carbonyl)-2,3-dihydro-1,4-benzoxazin-2-yl]methanone (PubChem CID 8944893) has the molecular formula C24H28N2O3S and a molecular weight of 424.57 g/mol. Its IUPAC name is piperidin-1-yl-[(2R)-4-(5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carbonyl)-2,3-dihydro-1,4-benzoxazin-2-yl]methanone.
| Compound Name | piperidin-1-yl-[(2R)-4-(5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carbonyl)-2,3-dihydro-1,4-benzoxazin-2-yl]methanone |
|---|---|
| PubChem CID | 8944893 |
| Molecular Formula | C24H28N2O3S |
| Molecular Weight | 424.57 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | piperidin-1-yl-[(2R)-4-(5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carbonyl)-2,3-dihydro-1,4-benzoxazin-2-yl]methanone |
| SMILES | O=C([C@H]1CN(C(=O)c2cc3c(s2)CCCCC3)c2ccccc2O1)N1CCCCC1 |
| InChI | InChI=1S/C24H28N2O3S/c27-23(25-13-7-2-8-14-25)20-16-26(18-10-5-6-11-19(18)29-20)24(28)22-15-17-9-3-1-4-12-21(17)30-22/h5-6,10-11,15,20H,1-4,7-9,12-14,16H2/t20-/m1/s1 |
| InChIKey | FFOHTMXLDRIVOH-HXUWFJFHSA-N |
| XLogP | 4.44 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.57 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |