C18H18FN3O4 — CID 166431175
3-[[6-[[3-fluoro-3-(hydroxymethyl)cyclobutanecarbonyl]amino]-3-pyridinyl]oxy]benzamide (PubChem CID 166431175) has the molecular formula C18H18FN3O4 and a molecular weight of 359.36 g/mol. Its IUPAC name is 3-[[6-[[3-fluoro-3-(hydroxymethyl)cyclobutanecarbonyl]amino]-3-pyridinyl]oxy]benzamide.
| Compound Name | 3-[[6-[[3-fluoro-3-(hydroxymethyl)cyclobutanecarbonyl]amino]-3-pyridinyl]oxy]benzamide |
|---|---|
| PubChem CID | 166431175 |
| Molecular Formula | C18H18FN3O4 |
| Molecular Weight | 359.36 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | 3-[[6-[[3-fluoro-3-(hydroxymethyl)cyclobutanecarbonyl]amino]-3-pyridinyl]oxy]benzamide |
| SMILES | NC(=O)c1cccc(Oc2ccc(NC(=O)C3CC(F)(CO)C3)nc2)c1 |
| InChI | InChI=1S/C18H18FN3O4/c19-18(10-23)7-12(8-18)17(25)22-15-5-4-14(9-21-15)26-13-3-1-2-11(6-13)16(20)24/h1-6,9,12,23H,7-8,10H2,(H2,20,24)(H,21,22,25) |
| InChIKey | CJOAOILKNFMPDW-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 114.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.36 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |