C13H14N2OS2 — CID 166431553
N-(1,2-thiazol-4-ylmethyl)-N-[(1S)-1-thiophen-2-ylethyl]prop-2-enamide (PubChem CID 166431553) has the molecular formula C13H14N2OS2 and a molecular weight of 278.40 g/mol. Its IUPAC name is N-(1,2-thiazol-4-ylmethyl)-N-[(1S)-1-thiophen-2-ylethyl]prop-2-enamide.
| Compound Name | N-(1,2-thiazol-4-ylmethyl)-N-[(1S)-1-thiophen-2-ylethyl]prop-2-enamide |
|---|---|
| PubChem CID | 166431553 |
| Molecular Formula | C13H14N2OS2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.05 |
| IUPAC Name | N-(1,2-thiazol-4-ylmethyl)-N-[(1S)-1-thiophen-2-ylethyl]prop-2-enamide |
| SMILES | C=CC(=O)N(Cc1cnsc1)[C@@H](C)c1cccs1 |
| InChI | InChI=1S/C13H14N2OS2/c1-3-13(16)15(8-11-7-14-18-9-11)10(2)12-5-4-6-17-12/h3-7,9-10H,1,8H2,2H3/t10-/m0/s1 |
| InChIKey | PLGNRQJTCWMCFE-JTQLQIEISA-N |
| XLogP | 3.48 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|