C25H26N2O2S — CID 166421865
N-[[2-[2-[benzyl(1-thiophen-2-ylethyl)amino]-2-oxoethyl]phenyl]methyl]prop-2-enamide (PubChem CID 166421865) has the molecular formula C25H26N2O2S and a molecular weight of 418.56 g/mol. Its IUPAC name is N-[[2-[2-[benzyl(1-thiophen-2-ylethyl)amino]-2-oxoethyl]phenyl]methyl]prop-2-enamide.
| Compound Name | N-[[2-[2-[benzyl(1-thiophen-2-ylethyl)amino]-2-oxoethyl]phenyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 166421865 |
| Molecular Formula | C25H26N2O2S |
| Molecular Weight | 418.56 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | N-[[2-[2-[benzyl(1-thiophen-2-ylethyl)amino]-2-oxoethyl]phenyl]methyl]prop-2-enamide |
| SMILES | C=CC(=O)NCc1ccccc1CC(=O)N(Cc1ccccc1)C(C)c1cccs1 |
| InChI | InChI=1S/C25H26N2O2S/c1-3-24(28)26-17-22-13-8-7-12-21(22)16-25(29)27(18-20-10-5-4-6-11-20)19(2)23-14-9-15-30-23/h3-15,19H,1,16-18H2,2H3,(H,26,28) |
| InChIKey | GZFBDSADFOORRY-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.56 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|