C19H25N3O2S — CID 52512096
N-benzyl-N-ethyl-2-[[methyl-[(1R)-1-thiophen-2-ylethyl]carbamoyl]amino]acetamide (PubChem CID 52512096) has the molecular formula C19H25N3O2S and a molecular weight of 359.50 g/mol. Its IUPAC name is N-benzyl-N-ethyl-2-[[methyl-[(1R)-1-thiophen-2-ylethyl]carbamoyl]amino]acetamide.
| Compound Name | N-benzyl-N-ethyl-2-[[methyl-[(1R)-1-thiophen-2-ylethyl]carbamoyl]amino]acetamide |
|---|---|
| PubChem CID | 52512096 |
| Molecular Formula | C19H25N3O2S |
| Molecular Weight | 359.50 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | N-benzyl-N-ethyl-2-[[methyl-[(1R)-1-thiophen-2-ylethyl]carbamoyl]amino]acetamide |
| SMILES | CCN(Cc1ccccc1)C(=O)CNC(=O)N(C)[C@H](C)c1cccs1 |
| InChI | InChI=1S/C19H25N3O2S/c1-4-22(14-16-9-6-5-7-10-16)18(23)13-20-19(24)21(3)15(2)17-11-8-12-25-17/h5-12,15H,4,13-14H2,1-3H3,(H,20,24)/t15-/m1/s1 |
| InChIKey | VGJKJXLZNGLJMZ-OAHLLOKOSA-N |
| XLogP | 3.50 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.50 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |