C7H7ClF3N3O2 — CID 166431725
2-chloro-N-[[5-(2,2,2-trifluoroethyl)-1,2,4-oxadiazol-3-yl]methyl]acetamide (PubChem CID 166431725) has the molecular formula C7H7ClF3N3O2 and a molecular weight of 257.60 g/mol. Its IUPAC name is 2-chloro-N-[[5-(2,2,2-trifluoroethyl)-1,2,4-oxadiazol-3-yl]methyl]acetamide.
| Compound Name | 2-chloro-N-[[5-(2,2,2-trifluoroethyl)-1,2,4-oxadiazol-3-yl]methyl]acetamide |
|---|---|
| PubChem CID | 166431725 |
| Molecular Formula | C7H7ClF3N3O2 |
| Molecular Weight | 257.60 g/mol |
| Exact Mass | 257.02 |
| IUPAC Name | 2-chloro-N-[[5-(2,2,2-trifluoroethyl)-1,2,4-oxadiazol-3-yl]methyl]acetamide |
| SMILES | O=C(CCl)NCc1noc(CC(F)(F)F)n1 |
| InChI | InChI=1S/C7H7ClF3N3O2/c8-2-5(15)12-3-4-13-6(16-14-4)1-7(9,10)11/h1-3H2,(H,12,15) |
| InChIKey | JWRAVJQUFCKULT-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.60 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|