C8H10ClN3O — CID 166416285
2-chloro-N-[(4-methylpyrimidin-2-yl)methyl]acetamide (PubChem CID 166416285) has the molecular formula C8H10ClN3O and a molecular weight of 199.64 g/mol. Its IUPAC name is 2-chloro-N-[(4-methylpyrimidin-2-yl)methyl]acetamide.
| Compound Name | 2-chloro-N-[(4-methylpyrimidin-2-yl)methyl]acetamide |
|---|---|
| PubChem CID | 166416285 |
| Molecular Formula | C8H10ClN3O |
| Molecular Weight | 199.64 g/mol |
| Exact Mass | 199.05 |
| IUPAC Name | 2-chloro-N-[(4-methylpyrimidin-2-yl)methyl]acetamide |
| SMILES | Cc1ccnc(CNC(=O)CCl)n1 |
| InChI | InChI=1S/C8H10ClN3O/c1-6-2-3-10-7(12-6)5-11-8(13)4-9/h2-3H,4-5H2,1H3,(H,11,13) |
| InChIKey | QWDVZZIAHMMAHS-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.64 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|