C19H20BNO5 — CID 166432580
[2-formyl-4-(8-methoxy-2,3,4,5-tetrahydro-1-benzazepine-1-carbonyl)phenyl]boronic acid (PubChem CID 166432580) has the molecular formula C19H20BNO5 and a molecular weight of 353.18 g/mol. Its IUPAC name is [2-formyl-4-(8-methoxy-2,3,4,5-tetrahydro-1-benzazepine-1-carbonyl)phenyl]boronic acid.
| Compound Name | [2-formyl-4-(8-methoxy-2,3,4,5-tetrahydro-1-benzazepine-1-carbonyl)phenyl]boronic acid |
|---|---|
| PubChem CID | 166432580 |
| Molecular Formula | C19H20BNO5 |
| Molecular Weight | 353.18 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | [2-formyl-4-(8-methoxy-2,3,4,5-tetrahydro-1-benzazepine-1-carbonyl)phenyl]boronic acid |
| SMILES | COc1ccc2c(c1)N(C(=O)c1ccc(B(O)O)c(C=O)c1)CCCC2 |
| InChI | InChI=1S/C19H20BNO5/c1-26-16-7-5-13-4-2-3-9-21(18(13)11-16)19(23)14-6-8-17(20(24)25)15(10-14)12-22/h5-8,10-12,24-25H,2-4,9H2,1H3 |
| InChIKey | LNTGZBMKUFZADO-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.18 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|