C31H26Cl2N2O2 — CID 166436121
3-[2,6-bis(4-chlorophenyl)-4-pyridinyl]-2-butoxy-6-methoxyquinoline (PubChem CID 166436121) has the molecular formula C31H26Cl2N2O2 and a molecular weight of 529.47 g/mol. Its IUPAC name is 3-[2,6-bis(4-chlorophenyl)-4-pyridinyl]-2-butoxy-6-methoxyquinoline.
| Compound Name | 3-[2,6-bis(4-chlorophenyl)-4-pyridinyl]-2-butoxy-6-methoxyquinoline |
|---|---|
| PubChem CID | 166436121 |
| Molecular Formula | C31H26Cl2N2O2 |
| Molecular Weight | 529.47 g/mol |
| Exact Mass | 528.14 |
| IUPAC Name | 3-[2,6-bis(4-chlorophenyl)-4-pyridinyl]-2-butoxy-6-methoxyquinoline |
| SMILES | CCCCOc1nc2ccc(OC)cc2cc1-c1cc(-c2ccc(Cl)cc2)nc(-c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C31H26Cl2N2O2/c1-3-4-15-37-31-27(17-23-16-26(36-2)13-14-28(23)35-31)22-18-29(20-5-9-24(32)10-6-20)34-30(19-22)21-7-11-25(33)12-8-21/h5-14,16-19H,3-4,15H2,1-2H3 |
| InChIKey | ICJPYSRGMKYAIJ-UHFFFAOYSA-N |
| XLogP | 9.13 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.47 |
| LogP ≤ 5 | 9.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|