C31H26Cl2N2O — CID 166436132
3-[2,6-bis(4-chlorophenyl)-4-pyridinyl]-2-butoxy-8-methylquinoline (PubChem CID 166436132) has the molecular formula C31H26Cl2N2O and a molecular weight of 513.47 g/mol. Its IUPAC name is 3-[2,6-bis(4-chlorophenyl)-4-pyridinyl]-2-butoxy-8-methylquinoline.
| Compound Name | 3-[2,6-bis(4-chlorophenyl)-4-pyridinyl]-2-butoxy-8-methylquinoline |
|---|---|
| PubChem CID | 166436132 |
| Molecular Formula | C31H26Cl2N2O |
| Molecular Weight | 513.47 g/mol |
| Exact Mass | 512.14 |
| IUPAC Name | 3-[2,6-bis(4-chlorophenyl)-4-pyridinyl]-2-butoxy-8-methylquinoline |
| SMILES | CCCCOc1nc2c(C)cccc2cc1-c1cc(-c2ccc(Cl)cc2)nc(-c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C31H26Cl2N2O/c1-3-4-16-36-31-27(17-23-7-5-6-20(2)30(23)35-31)24-18-28(21-8-12-25(32)13-9-21)34-29(19-24)22-10-14-26(33)15-11-22/h5-15,17-19H,3-4,16H2,1-2H3 |
| InChIKey | REOJSVDKNQAFOU-UHFFFAOYSA-N |
| XLogP | 9.42 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.47 |
| LogP ≤ 5 | 9.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|