C26H23NO6 — CID 166437686
[9-(acetyloxymethyl)-1-phenyldec-9-en-1,6-diyn-5-yl] 4-nitrobenzoate (PubChem CID 166437686) has the molecular formula C26H23NO6 and a molecular weight of 445.47 g/mol. Its IUPAC name is [9-(acetyloxymethyl)-1-phenyldec-9-en-1,6-diyn-5-yl] 4-nitrobenzoate.
| Compound Name | [9-(acetyloxymethyl)-1-phenyldec-9-en-1,6-diyn-5-yl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 166437686 |
| Molecular Formula | C26H23NO6 |
| Molecular Weight | 445.47 g/mol |
| Exact Mass | 445.15 |
| IUPAC Name | [9-(acetyloxymethyl)-1-phenyldec-9-en-1,6-diyn-5-yl] 4-nitrobenzoate |
| SMILES | C=C(CC#CC(CCC#Cc1ccccc1)OC(=O)c1ccc([N+](=O)[O-])cc1)COC(C)=O |
| InChI | InChI=1S/C26H23NO6/c1-20(19-32-21(2)28)9-8-14-25(13-7-6-12-22-10-4-3-5-11-22)33-26(29)23-15-17-24(18-16-23)27(30)31/h3-5,10-11,15-18,25H,1,7,9,13,19H2,2H3 |
| InChIKey | MTQNDYUSYYZCTB-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.47 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|