C23H21NO5 — CID 166438118
[11-(furan-3-yl)-2-methylundec-1-en-4,10-diyn-6-yl] 4-nitrobenzoate (PubChem CID 166438118) has the molecular formula C23H21NO5 and a molecular weight of 391.42 g/mol. Its IUPAC name is [11-(furan-3-yl)-2-methylundec-1-en-4,10-diyn-6-yl] 4-nitrobenzoate.
| Compound Name | [11-(furan-3-yl)-2-methylundec-1-en-4,10-diyn-6-yl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 166438118 |
| Molecular Formula | C23H21NO5 |
| Molecular Weight | 391.42 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | [11-(furan-3-yl)-2-methylundec-1-en-4,10-diyn-6-yl] 4-nitrobenzoate |
| SMILES | C=C(C)CC#CC(CCCC#Cc1ccoc1)OC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H21NO5/c1-18(2)7-6-10-22(9-5-3-4-8-19-15-16-28-17-19)29-23(25)20-11-13-21(14-12-20)24(26)27/h11-17,22H,1,3,5,7,9H2,2H3 |
| InChIKey | RHDSSLLNRSWBLP-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 82.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.42 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|