C29H31NO4 — CID 166437069
[11-(4-tert-butylphenyl)-2-methylundec-1-en-4,10-diyn-6-yl] 4-nitrobenzoate (PubChem CID 166437069) has the molecular formula C29H31NO4 and a molecular weight of 457.57 g/mol. Its IUPAC name is [11-(4-tert-butylphenyl)-2-methylundec-1-en-4,10-diyn-6-yl] 4-nitrobenzoate.
| Compound Name | [11-(4-tert-butylphenyl)-2-methylundec-1-en-4,10-diyn-6-yl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 166437069 |
| Molecular Formula | C29H31NO4 |
| Molecular Weight | 457.57 g/mol |
| Exact Mass | 457.23 |
| IUPAC Name | [11-(4-tert-butylphenyl)-2-methylundec-1-en-4,10-diyn-6-yl] 4-nitrobenzoate |
| SMILES | C=C(C)CC#CC(CCCC#Cc1ccc(C(C)(C)C)cc1)OC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C29H31NO4/c1-22(2)10-9-13-27(34-28(31)24-16-20-26(21-17-24)30(32)33)12-8-6-7-11-23-14-18-25(19-15-23)29(3,4)5/h14-21,27H,1,6,8,10,12H2,2-5H3 |
| InChIKey | FVWRYMQXRKVFDS-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.57 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|