C18H21NO — CID 166439438
cis-(1S,2R)-2-(N-phenylanilino)cyclohexan-1-ol (PubChem CID 166439438) has the molecular formula C18H21NO and a molecular weight of 267.37 g/mol. Its IUPAC name is cis-(1S,2R)-2-(N-phenylanilino)cyclohexan-1-ol.
| Compound Name | cis-(1S,2R)-2-(N-phenylanilino)cyclohexan-1-ol |
|---|---|
| PubChem CID | 166439438 |
| Molecular Formula | C18H21NO |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | cis-(1S,2R)-2-(N-phenylanilino)cyclohexan-1-ol |
| SMILES | O[C@H]1CCCC[C@H]1N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H21NO/c20-18-14-8-7-13-17(18)19(15-9-3-1-4-10-15)16-11-5-2-6-12-16/h1-6,9-12,17-18,20H,7-8,13-14H2/t17-,18+/m1/s1 |
| InChIKey | RAQAOTDRMRWQJU-MSOLQXFVSA-N |
| XLogP | 4.13 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |