C18H14FNO3 — CID 166439801
3-[(E)-2-(4-fluorophenyl)-3-phenylprop-2-enoyl]-1,3-oxazolidin-2-one (PubChem CID 166439801) has the molecular formula C18H14FNO3 and a molecular weight of 311.31 g/mol. Its IUPAC name is 3-[(E)-2-(4-fluorophenyl)-3-phenylprop-2-enoyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[(E)-2-(4-fluorophenyl)-3-phenylprop-2-enoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 166439801 |
| Molecular Formula | C18H14FNO3 |
| Molecular Weight | 311.31 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | 3-[(E)-2-(4-fluorophenyl)-3-phenylprop-2-enoyl]-1,3-oxazolidin-2-one |
| SMILES | O=C1OCCN1C(=O)/C(=C/c1ccccc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H14FNO3/c19-15-8-6-14(7-9-15)16(12-13-4-2-1-3-5-13)17(21)20-10-11-23-18(20)22/h1-9,12H,10-11H2/b16-12+ |
| InChIKey | NMOWZDMJXGYUQP-FOWTUZBSSA-N |
| XLogP | 3.35 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.31 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|