C32H60B4O8 — CID 166440799
2-[1-cyclohexyl-1,2,2-tris(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 166440799) has the molecular formula C32H60B4O8 and a molecular weight of 616.07 g/mol. Its IUPAC name is 2-[1-cyclohexyl-1,2,2-tris(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[1-cyclohexyl-1,2,2-tris(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 166440799 |
| Molecular Formula | C32H60B4O8 |
| Molecular Weight | 616.07 g/mol |
| Exact Mass | 616.47 |
| IUPAC Name | 2-[1-cyclohexyl-1,2,2-tris(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(C(B2OC(C)(C)C(C)(C)O2)C(B2OC(C)(C)C(C)(C)O2)(B2OC(C)(C)C(C)(C)O2)C2CCCCC2)OC1(C)C |
| InChI | InChI=1S/C32H60B4O8/c1-24(2)25(3,4)38-33(37-24)23(34-39-26(5,6)27(7,8)40-34)32(22-20-18-17-19-21-22,35-41-28(9,10)29(11,12)42-35)36-43-30(13,14)31(15,16)44-36/h22-23H,17-21H2,1-16H3 |
| InChIKey | ASPWASXFNCPHIX-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.07 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|