C33H64B4O8 — CID 154713112
4,4,5,5-tetramethyl-2-[1,9,9-tris(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)nonyl]-1,3,2-dioxaborolane (PubChem CID 154713112) has the molecular formula C33H64B4O8 and a molecular weight of 632.12 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[1,9,9-tris(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)nonyl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[1,9,9-tris(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)nonyl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 154713112 |
| Molecular Formula | C33H64B4O8 |
| Molecular Weight | 632.12 g/mol |
| Exact Mass | 632.50 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[1,9,9-tris(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)nonyl]-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(C(CCCCCCCC(B2OC(C)(C)C(C)(C)O2)B2OC(C)(C)C(C)(C)O2)B2OC(C)(C)C(C)(C)O2)OC1(C)C |
| InChI | InChI=1S/C33H64B4O8/c1-26(2)27(3,4)39-34(38-26)24(35-40-28(5,6)29(7,8)41-35)22-20-18-17-19-21-23-25(36-42-30(9,10)31(11,12)43-36)37-44-32(13,14)33(15,16)45-37/h24-25H,17-23H2,1-16H3 |
| InChIKey | LLYVLFDPLWXEFD-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.12 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|