C34H62B4O8 — CID 166440801
4,4,5,5-tetramethyl-2-[1,1,2-tris(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dec-5-yn-2-yl]-1,3,2-dioxaborolane (PubChem CID 166440801) has the molecular formula C34H62B4O8 and a molecular weight of 642.11 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[1,1,2-tris(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dec-5-yn-2-yl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[1,1,2-tris(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dec-5-yn-2-yl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 166440801 |
| Molecular Formula | C34H62B4O8 |
| Molecular Weight | 642.11 g/mol |
| Exact Mass | 642.48 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[1,1,2-tris(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dec-5-yn-2-yl]-1,3,2-dioxaborolane |
| SMILES | CCCCC#CCCC(B1OC(C)(C)C(C)(C)O1)(B1OC(C)(C)C(C)(C)O1)C(B1OC(C)(C)C(C)(C)O1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C34H62B4O8/c1-18-19-20-21-22-23-24-34(37-43-30(10,11)31(12,13)44-37,38-45-32(14,15)33(16,17)46-38)25(35-39-26(2,3)27(4,5)40-35)36-41-28(6,7)29(8,9)42-36/h25H,18-20,23-24H2,1-17H3 |
| InChIKey | NOUHFDHDDYLSTJ-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.11 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|