C38H72B6O12 — CID 132837452
4,4,5,5-tetramethyl-2-[1,1,2,2,2-pentakis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]-1,3,2-dioxaborolane (PubChem CID 132837452) has the molecular formula C38H72B6O12 and a molecular weight of 785.85 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[1,1,2,2,2-pentakis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[1,1,2,2,2-pentakis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 132837452 |
| Molecular Formula | C38H72B6O12 |
| Molecular Weight | 785.85 g/mol |
| Exact Mass | 786.56 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[1,1,2,2,2-pentakis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(C(B2OC(C)(C)C(C)(C)O2)(B2OC(C)(C)C(C)(C)O2)C(B2OC(C)(C)C(C)(C)O2)(B2OC(C)(C)C(C)(C)O2)B2OC(C)(C)C(C)(C)O2)OC1(C)C |
| InChI | InChI=1S/C38H72B6O12/c1-25(2)26(3,4)46-39(45-25)37(40-47-27(5,6)28(7,8)48-40,41-49-29(9,10)30(11,12)50-41)38(42-51-31(13,14)32(15,16)52-42,43-53-33(17,18)34(19,20)54-43)44-55-35(21,22)36(23,24)56-44/h1-24H3 |
| InChIKey | NHEJQJWGRXLLLK-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 110.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 785.85 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|