C25H48B4O8 — CID 132837451
4,4,5,5-tetramethyl-2-[tris(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]-1,3,2-dioxaborolane (PubChem CID 132837451) has the molecular formula C25H48B4O8 and a molecular weight of 519.90 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[tris(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[tris(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 132837451 |
| Molecular Formula | C25H48B4O8 |
| Molecular Weight | 519.90 g/mol |
| Exact Mass | 520.37 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[tris(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(C(B2OC(C)(C)C(C)(C)O2)(B2OC(C)(C)C(C)(C)O2)B2OC(C)(C)C(C)(C)O2)OC1(C)C |
| InChI | InChI=1S/C25H48B4O8/c1-17(2)18(3,4)31-26(30-17)25(27-32-19(5,6)20(7,8)33-27,28-34-21(9,10)22(11,12)35-28)29-36-23(13,14)24(15,16)37-29/h1-16H3 |
| InChIKey | ZBVUQRVVZNCUNU-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.90 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|