C29H56B4O8 — CID 165416682
4,4,5,5-tetramethyl-2-[(2R,4R)-1,4,5-tris(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pentan-2-yl]-1,3,2-dioxaborolane (PubChem CID 165416682) has the molecular formula C29H56B4O8 and a molecular weight of 576.01 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[(2R,4R)-1,4,5-tris(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pentan-2-yl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[(2R,4R)-1,4,5-tris(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pentan-2-yl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 165416682 |
| Molecular Formula | C29H56B4O8 |
| Molecular Weight | 576.01 g/mol |
| Exact Mass | 576.43 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[(2R,4R)-1,4,5-tris(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pentan-2-yl]-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(C[C@H](C[C@@H](CB2OC(C)(C)C(C)(C)O2)B2OC(C)(C)C(C)(C)O2)B2OC(C)(C)C(C)(C)O2)OC1(C)C |
| InChI | InChI=1S/C29H56B4O8/c1-22(2)23(3,4)35-30(34-22)18-20(32-38-26(9,10)27(11,12)39-32)17-21(33-40-28(13,14)29(15,16)41-33)19-31-36-24(5,6)25(7,8)37-31/h20-21H,17-19H2,1-16H3/t20-,21-/m0/s1 |
| InChIKey | MWKGTCPUCUXHPJ-SFTDATJTSA-N |
| XLogP | 6.49 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.01 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|