C24H47B3O6 — CID 154712536
4,4,5,5-tetramethyl-2-[(2R)-4-methyl-1,1-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pentan-2-yl]-1,3,2-dioxaborolane (PubChem CID 154712536) has the molecular formula C24H47B3O6 and a molecular weight of 464.07 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[(2R)-4-methyl-1,1-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pentan-2-yl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[(2R)-4-methyl-1,1-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pentan-2-yl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 154712536 |
| Molecular Formula | C24H47B3O6 |
| Molecular Weight | 464.07 g/mol |
| Exact Mass | 464.37 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[(2R)-4-methyl-1,1-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pentan-2-yl]-1,3,2-dioxaborolane |
| SMILES | CC(C)C[C@H](B1OC(C)(C)C(C)(C)O1)C(B1OC(C)(C)C(C)(C)O1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C24H47B3O6/c1-16(2)15-17(25-28-19(3,4)20(5,6)29-25)18(26-30-21(7,8)22(9,10)31-26)27-32-23(11,12)24(13,14)33-27/h16-18H,15H2,1-14H3/t17-/m0/s1 |
| InChIKey | QEGRWHZYLMQHIP-KRWDZBQOSA-N |
| XLogP | 5.59 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.07 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|