C22H44B2O4Zn — CID 86231835
zinc bis(4,4,5,5-tetramethyl-2-pentyl-1,3,2-dioxaborolane) (PubChem CID 86231835) has the molecular formula C22H44B2O4Zn and a molecular weight of 459.60 g/mol. Its IUPAC name is zinc bis(4,4,5,5-tetramethyl-2-pentyl-1,3,2-dioxaborolane).
| Compound Name | zinc bis(4,4,5,5-tetramethyl-2-pentyl-1,3,2-dioxaborolane) |
|---|---|
| PubChem CID | 86231835 |
| Molecular Formula | C22H44B2O4Zn |
| Molecular Weight | 459.60 g/mol |
| Exact Mass | 458.27 |
| IUPAC Name | zinc bis(4,4,5,5-tetramethyl-2-pentyl-1,3,2-dioxaborolane) |
| SMILES | [CH2-]CCCCB1OC(C)(C)C(C)(C)O1.[CH2-]CCCCB1OC(C)(C)C(C)(C)O1.[Zn+2] |
| InChI | InChI=1S/2C11H22BO2.Zn/c2*1-6-7-8-9-12-13-10(2,3)11(4,5)14-12;/h2*1,6-9H2,2-5H3;/q2*-1;+2 |
| InChIKey | JVIXGEHLMNPMSP-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.60 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|