C33H63B5O10 — CID 177454416
4,4,5,5-tetramethyl-2-[1,1,3,3-tetrakis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propan-2-yl]-1,3,2-dioxaborolane (PubChem CID 177454416) has the molecular formula C33H63B5O10 and a molecular weight of 673.92 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[1,1,3,3-tetrakis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propan-2-yl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[1,1,3,3-tetrakis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propan-2-yl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 177454416 |
| Molecular Formula | C33H63B5O10 |
| Molecular Weight | 673.92 g/mol |
| Exact Mass | 674.49 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[1,1,3,3-tetrakis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propan-2-yl]-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(C(B2OC(C)(C)C(C)(C)O2)C(B2OC(C)(C)C(C)(C)O2)C(B2OC(C)(C)C(C)(C)O2)B2OC(C)(C)C(C)(C)O2)OC1(C)C |
| InChI | InChI=1S/C33H63B5O10/c1-24(2)25(3,4)40-34(39-24)21(22(35-41-26(5,6)27(7,8)42-35)36-43-28(9,10)29(11,12)44-36)23(37-45-30(13,14)31(15,16)46-37)38-47-32(17,18)33(19,20)48-38/h21-23H,1-20H3 |
| InChIKey | BVRABSWPDPQFNY-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 92.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.92 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|