C19H21NO — CID 166441391
7-methoxy-4-phenyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene (PubChem CID 166441391) has the molecular formula C19H21NO and a molecular weight of 279.38 g/mol. Its IUPAC name is 7-methoxy-4-phenyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene.
| Compound Name | 7-methoxy-4-phenyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene |
|---|---|
| PubChem CID | 166441391 |
| Molecular Formula | C19H21NO |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | 7-methoxy-4-phenyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene |
| SMILES | COc1cc2c3c(c1)C(c1ccccc1)CCN3CCC2 |
| InChI | InChI=1S/C19H21NO/c1-21-16-12-15-8-5-10-20-11-9-17(18(13-16)19(15)20)14-6-3-2-4-7-14/h2-4,6-7,12-13,17H,5,8-11H2,1H3 |
| InChIKey | WSOFNTLOLNYYPG-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|