C31H27BrN2 — CID 40737112
1-(4-bromophenyl)-N-[(4S,10S)-4,10-diphenyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl]methanimine (PubChem CID 40737112) has the molecular formula C31H27BrN2 and a molecular weight of 507.48 g/mol. Its IUPAC name is 1-(4-bromophenyl)-N-[(4S,10S)-4,10-diphenyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl]methanimine.
| Compound Name | 1-(4-bromophenyl)-N-[(4S,10S)-4,10-diphenyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl]methanimine |
|---|---|
| PubChem CID | 40737112 |
| Molecular Formula | C31H27BrN2 |
| Molecular Weight | 507.48 g/mol |
| Exact Mass | 506.14 |
| IUPAC Name | 1-(4-bromophenyl)-N-[(4S,10S)-4,10-diphenyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl]methanimine |
| SMILES | Brc1ccc(/C=N/c2cc3c4c(c2)[C@H](c2ccccc2)CCN4CC[C@H]3c2ccccc2)cc1 |
| InChI | InChI=1S/C31H27BrN2/c32-25-13-11-22(12-14-25)21-33-26-19-29-27(23-7-3-1-4-8-23)15-17-34-18-16-28(30(20-26)31(29)34)24-9-5-2-6-10-24/h1-14,19-21,27-28H,15-18H2/b33-21+/t27-,28-/m0/s1 |
| InChIKey | VXBZMICCRSTHGZ-QPFURMFPSA-N |
| XLogP | 8.08 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.48 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|