C37H34BrN3O3S — CID 137122178
(5Z)-5-[(3-bromo-4-ethoxy-5-methoxyphenyl)methylidene]-2-[[(4R,10S)-4,10-diphenyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl]imino]-1,3-thiazolidin-4-one (PubChem CID 137122178) has the molecular formula C37H34BrN3O3S and a molecular weight of 680.67 g/mol. Its IUPAC name is (5Z)-5-[(3-bromo-4-ethoxy-5-methoxyphenyl)methylidene]-2-[[(4R,10S)-4,10-diphenyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl]imino]-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[(3-bromo-4-ethoxy-5-methoxyphenyl)methylidene]-2-[[(4R,10S)-4,10-diphenyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl]imino]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137122178 |
| Molecular Formula | C37H34BrN3O3S |
| Molecular Weight | 680.67 g/mol |
| Exact Mass | 679.15 |
| IUPAC Name | (5Z)-5-[(3-bromo-4-ethoxy-5-methoxyphenyl)methylidene]-2-[[(4R,10S)-4,10-diphenyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl]imino]-1,3-thiazolidin-4-one |
| SMILES | CCOc1c(Br)cc(/C=C2\S/C(=N/c3cc4c5c(c3)[C@H](c3ccccc3)CCN5CC[C@@H]4c3ccccc3)NC2=O)cc1OC |
| InChI | InChI=1S/C37H34BrN3O3S/c1-3-44-35-31(38)18-23(19-32(35)43-2)20-33-36(42)40-37(45-33)39-26-21-29-27(24-10-6-4-7-11-24)14-16-41-17-15-28(30(22-26)34(29)41)25-12-8-5-9-13-25/h4-13,18-22,27-28H,3,14-17H2,1-2H3,(H,39,40,42)/b33-20-/t27-,28+ |
| InChIKey | YUTRWGVADATKHF-NTTWTPJUSA-N |
| XLogP | 8.63 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.67 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|