C38H34BrN3O3S — CID 137121979
(5Z)-5-[(3-bromo-5-methoxy-4-prop-2-enoxyphenyl)methylidene]-2-[[(4R,10S)-4,10-diphenyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl]imino]-1,3-thiazolidin-4-one (PubChem CID 137121979) has the molecular formula C38H34BrN3O3S and a molecular weight of 692.68 g/mol. Its IUPAC name is (5Z)-5-[(3-bromo-5-methoxy-4-prop-2-enoxyphenyl)methylidene]-2-[[(4R,10S)-4,10-diphenyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl]imino]-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[(3-bromo-5-methoxy-4-prop-2-enoxyphenyl)methylidene]-2-[[(4R,10S)-4,10-diphenyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl]imino]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137121979 |
| Molecular Formula | C38H34BrN3O3S |
| Molecular Weight | 692.68 g/mol |
| Exact Mass | 691.15 |
| IUPAC Name | (5Z)-5-[(3-bromo-5-methoxy-4-prop-2-enoxyphenyl)methylidene]-2-[[(4R,10S)-4,10-diphenyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl]imino]-1,3-thiazolidin-4-one |
| SMILES | C=CCOc1c(Br)cc(/C=C2\S/C(=N/c3cc4c5c(c3)[C@H](c3ccccc3)CCN5CC[C@@H]4c3ccccc3)NC2=O)cc1OC |
| InChI | InChI=1S/C38H34BrN3O3S/c1-3-18-45-36-32(39)19-24(20-33(36)44-2)21-34-37(43)41-38(46-34)40-27-22-30-28(25-10-6-4-7-11-25)14-16-42-17-15-29(31(23-27)35(30)42)26-12-8-5-9-13-26/h3-13,19-23,28-29H,1,14-18H2,2H3,(H,40,41,43)/b34-21-/t28-,29+ |
| InChIKey | UGKNWQNZCHTCNY-ZMDLKHIMSA-N |
| XLogP | 8.79 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.68 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|