C36H31N3O4S — CID 137107360
5-[(Z)-[2-[[(4R,10R)-4,10-diphenyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl]imino]-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxybenzoic acid (PubChem CID 137107360) has the molecular formula C36H31N3O4S and a molecular weight of 601.73 g/mol. Its IUPAC name is 5-[(Z)-[2-[[(4R,10R)-4,10-diphenyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl]imino]-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxybenzoic acid.
| Compound Name | 5-[(Z)-[2-[[(4R,10R)-4,10-diphenyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl]imino]-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxybenzoic acid |
|---|---|
| PubChem CID | 137107360 |
| Molecular Formula | C36H31N3O4S |
| Molecular Weight | 601.73 g/mol |
| Exact Mass | 601.20 |
| IUPAC Name | 5-[(Z)-[2-[[(4R,10R)-4,10-diphenyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl]imino]-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxybenzoic acid |
| SMILES | COc1ccc(/C=C2\S/C(=N/c3cc4c5c(c3)[C@@H](c3ccccc3)CCN5CC[C@@H]4c3ccccc3)NC2=O)cc1C(=O)O |
| InChI | InChI=1S/C36H31N3O4S/c1-43-31-13-12-22(18-30(31)35(41)42)19-32-34(40)38-36(44-32)37-25-20-28-26(23-8-4-2-5-9-23)14-16-39-17-15-27(29(21-25)33(28)39)24-10-6-3-7-11-24/h2-13,18-21,26-27H,14-17H2,1H3,(H,41,42)(H,37,38,40)/b32-19-/t26-,27-/m1/s1 |
| InChIKey | ZOFIRSLEEFGWAD-NQVAYNGISA-N |
| XLogP | 7.16 |
| TPSA | 91.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.73 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|