C36H32IN3O3S — CID 137122280
(5Z)-2-[[(4S,10S)-4,10-diphenyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl]imino]-5-[(3-iodo-4,5-dimethoxyphenyl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 137122280) has the molecular formula C36H32IN3O3S and a molecular weight of 713.64 g/mol. Its IUPAC name is (5Z)-2-[[(4S,10S)-4,10-diphenyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl]imino]-5-[(3-iodo-4,5-dimethoxyphenyl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-2-[[(4S,10S)-4,10-diphenyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl]imino]-5-[(3-iodo-4,5-dimethoxyphenyl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137122280 |
| Molecular Formula | C36H32IN3O3S |
| Molecular Weight | 713.64 g/mol |
| Exact Mass | 713.12 |
| IUPAC Name | (5Z)-2-[[(4S,10S)-4,10-diphenyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl]imino]-5-[(3-iodo-4,5-dimethoxyphenyl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | COc1cc(/C=C2\S/C(=N/c3cc4c5c(c3)[C@H](c3ccccc3)CCN5CC[C@H]4c3ccccc3)NC2=O)cc(I)c1OC |
| InChI | InChI=1S/C36H32IN3O3S/c1-42-31-18-22(17-30(37)34(31)43-2)19-32-35(41)39-36(44-32)38-25-20-28-26(23-9-5-3-6-10-23)13-15-40-16-14-27(29(21-25)33(28)40)24-11-7-4-8-12-24/h3-12,17-21,26-27H,13-16H2,1-2H3,(H,38,39,41)/b32-19-/t26-,27-/m0/s1 |
| InChIKey | VBNPLTDKFKHKII-DQVYSVBZSA-N |
| XLogP | 8.08 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.64 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|