C38H37N3O3S — CID 137044609
(5Z)-2-[[(4R,10S)-4,10-diphenyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl]imino]-5-[(3-methoxy-4-propoxyphenyl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 137044609) has the molecular formula C38H37N3O3S and a molecular weight of 615.80 g/mol. Its IUPAC name is (5Z)-2-[[(4R,10S)-4,10-diphenyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl]imino]-5-[(3-methoxy-4-propoxyphenyl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-2-[[(4R,10S)-4,10-diphenyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl]imino]-5-[(3-methoxy-4-propoxyphenyl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137044609 |
| Molecular Formula | C38H37N3O3S |
| Molecular Weight | 615.80 g/mol |
| Exact Mass | 615.26 |
| IUPAC Name | (5Z)-2-[[(4R,10S)-4,10-diphenyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl]imino]-5-[(3-methoxy-4-propoxyphenyl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | CCCOc1ccc(/C=C2\S/C(=N/c3cc4c5c(c3)[C@H](c3ccccc3)CCN5CC[C@@H]4c3ccccc3)NC2=O)cc1OC |
| InChI | InChI=1S/C38H37N3O3S/c1-3-20-44-33-15-14-25(21-34(33)43-2)22-35-37(42)40-38(45-35)39-28-23-31-29(26-10-6-4-7-11-26)16-18-41-19-17-30(32(24-28)36(31)41)27-12-8-5-9-13-27/h4-15,21-24,29-30H,3,16-20H2,1-2H3,(H,39,40,42)/b35-22-/t29-,30+ |
| InChIKey | GYHLIDJTTSLUCS-FJZLOJTQSA-N |
| XLogP | 8.25 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.80 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|