C36H31N3O3S — CID 137044778
methyl 4-[(Z)-[2-[[(4R,10R)-4,10-diphenyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl]imino]-4-oxo-1,3-thiazolidin-5-ylidene]methyl]benzoate (PubChem CID 137044778) has the molecular formula C36H31N3O3S and a molecular weight of 585.73 g/mol. Its IUPAC name is methyl 4-[(Z)-[2-[[(4R,10R)-4,10-diphenyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl]imino]-4-oxo-1,3-thiazolidin-5-ylidene]methyl]benzoate.
| Compound Name | methyl 4-[(Z)-[2-[[(4R,10R)-4,10-diphenyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl]imino]-4-oxo-1,3-thiazolidin-5-ylidene]methyl]benzoate |
|---|---|
| PubChem CID | 137044778 |
| Molecular Formula | C36H31N3O3S |
| Molecular Weight | 585.73 g/mol |
| Exact Mass | 585.21 |
| IUPAC Name | methyl 4-[(Z)-[2-[[(4R,10R)-4,10-diphenyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl]imino]-4-oxo-1,3-thiazolidin-5-ylidene]methyl]benzoate |
| SMILES | COC(=O)c1ccc(/C=C2\S/C(=N/c3cc4c5c(c3)[C@@H](c3ccccc3)CCN5CC[C@@H]4c3ccccc3)NC2=O)cc1 |
| InChI | InChI=1S/C36H31N3O3S/c1-42-35(41)26-14-12-23(13-15-26)20-32-34(40)38-36(43-32)37-27-21-30-28(24-8-4-2-5-9-24)16-18-39-19-17-29(31(22-27)33(30)39)25-10-6-3-7-11-25/h2-15,20-22,28-29H,16-19H2,1H3,(H,37,38,40)/b32-20-/t28-,29-/m1/s1 |
| InChIKey | KWCPPFKXJNEDRK-JKLNDGLDSA-N |
| XLogP | 7.24 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.73 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|