C34H28ClN3OS — CID 137107364
(5Z)-5-[(4-chlorophenyl)methylidene]-2-[[(4R,10S)-4,10-diphenyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl]imino]-1,3-thiazolidin-4-one (PubChem CID 137107364) has the molecular formula C34H28ClN3OS and a molecular weight of 562.14 g/mol. Its IUPAC name is (5Z)-5-[(4-chlorophenyl)methylidene]-2-[[(4R,10S)-4,10-diphenyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl]imino]-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[(4-chlorophenyl)methylidene]-2-[[(4R,10S)-4,10-diphenyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl]imino]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137107364 |
| Molecular Formula | C34H28ClN3OS |
| Molecular Weight | 562.14 g/mol |
| Exact Mass | 561.16 |
| IUPAC Name | (5Z)-5-[(4-chlorophenyl)methylidene]-2-[[(4R,10S)-4,10-diphenyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl]imino]-1,3-thiazolidin-4-one |
| SMILES | O=C1N/C(=N\c2cc3c4c(c2)[C@H](c2ccccc2)CCN4CC[C@@H]3c2ccccc2)S/C1=C\c1ccc(Cl)cc1 |
| InChI | InChI=1S/C34H28ClN3OS/c35-25-13-11-22(12-14-25)19-31-33(39)37-34(40-31)36-26-20-29-27(23-7-3-1-4-8-23)15-17-38-18-16-28(30(21-26)32(29)38)24-9-5-2-6-10-24/h1-14,19-21,27-28H,15-18H2,(H,36,37,39)/b31-19-/t27-,28+ |
| InChIKey | FTQHCEXTVONQPK-MXLAILRNSA-N |
| XLogP | 8.11 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.14 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|