C38H31N3OS — CID 137122165
(5Z)-2-[[(4R,10R)-4,10-diphenyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl]imino]-5-(naphthalen-1-ylmethylidene)-1,3-thiazolidin-4-one (PubChem CID 137122165) has the molecular formula C38H31N3OS and a molecular weight of 577.75 g/mol. Its IUPAC name is (5Z)-2-[[(4R,10R)-4,10-diphenyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl]imino]-5-(naphthalen-1-ylmethylidene)-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-2-[[(4R,10R)-4,10-diphenyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl]imino]-5-(naphthalen-1-ylmethylidene)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137122165 |
| Molecular Formula | C38H31N3OS |
| Molecular Weight | 577.75 g/mol |
| Exact Mass | 577.22 |
| IUPAC Name | (5Z)-2-[[(4R,10R)-4,10-diphenyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl]imino]-5-(naphthalen-1-ylmethylidene)-1,3-thiazolidin-4-one |
| SMILES | O=C1N/C(=N\c2cc3c4c(c2)[C@@H](c2ccccc2)CCN4CC[C@@H]3c2ccccc2)S/C1=C\c1cccc2ccccc12 |
| InChI | InChI=1S/C38H31N3OS/c42-37-35(22-28-16-9-15-25-14-7-8-17-30(25)28)43-38(40-37)39-29-23-33-31(26-10-3-1-4-11-26)18-20-41-21-19-32(34(24-29)36(33)41)27-12-5-2-6-13-27/h1-17,22-24,31-32H,18-21H2,(H,39,40,42)/b35-22-/t31-,32-/m1/s1 |
| InChIKey | XDENQFTUJJHPLO-IFOFPXPVSA-N |
| XLogP | 8.61 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.75 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|