C32H29BrN2O2 — CID 136899928
2-bromo-4-[[(4R,10R)-4,10-diphenyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl]iminomethyl]-6-methoxyphenol (PubChem CID 136899928) has the molecular formula C32H29BrN2O2 and a molecular weight of 553.50 g/mol. Its IUPAC name is 2-bromo-4-[[(4R,10R)-4,10-diphenyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl]iminomethyl]-6-methoxyphenol.
| Compound Name | 2-bromo-4-[[(4R,10R)-4,10-diphenyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl]iminomethyl]-6-methoxyphenol |
|---|---|
| PubChem CID | 136899928 |
| Molecular Formula | C32H29BrN2O2 |
| Molecular Weight | 553.50 g/mol |
| Exact Mass | 552.14 |
| IUPAC Name | 2-bromo-4-[[(4R,10R)-4,10-diphenyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl]iminomethyl]-6-methoxyphenol |
| SMILES | COc1cc(/C=N/c2cc3c4c(c2)[C@@H](c2ccccc2)CCN4CC[C@@H]3c2ccccc2)cc(Br)c1O |
| InChI | InChI=1S/C32H29BrN2O2/c1-37-30-17-21(16-29(33)32(30)36)20-34-24-18-27-25(22-8-4-2-5-9-22)12-14-35-15-13-26(28(19-24)31(27)35)23-10-6-3-7-11-23/h2-11,16-20,25-26,36H,12-15H2,1H3/b34-20+/t25-,26-/m1/s1 |
| InChIKey | VVOWUEMHDHOZEJ-RFRGJBDASA-N |
| XLogP | 7.79 |
| TPSA | 45.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.50 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|