C29H23FN2O2S — CID 166442184
N-benzyl-N-(7-fluoro-2,3-diphenylquinolin-4-yl)methanesulfonamide (PubChem CID 166442184) has the molecular formula C29H23FN2O2S and a molecular weight of 482.58 g/mol. Its IUPAC name is N-benzyl-N-(7-fluoro-2,3-diphenylquinolin-4-yl)methanesulfonamide.
| Compound Name | N-benzyl-N-(7-fluoro-2,3-diphenylquinolin-4-yl)methanesulfonamide |
|---|---|
| PubChem CID | 166442184 |
| Molecular Formula | C29H23FN2O2S |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.15 |
| IUPAC Name | N-benzyl-N-(7-fluoro-2,3-diphenylquinolin-4-yl)methanesulfonamide |
| SMILES | CS(=O)(=O)N(Cc1ccccc1)c1c(-c2ccccc2)c(-c2ccccc2)nc2cc(F)ccc12 |
| InChI | InChI=1S/C29H23FN2O2S/c1-35(33,34)32(20-21-11-5-2-6-12-21)29-25-18-17-24(30)19-26(25)31-28(23-15-9-4-10-16-23)27(29)22-13-7-3-8-14-22/h2-19H,20H2,1H3 |
| InChIKey | PPMRGKSKIJINPH-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |