C15H20F3NO3S2 — CID 166443339
4-methoxy-N-[4-(trifluoromethylsulfanyl)cycloheptyl]benzenesulfonamide (PubChem CID 166443339) has the molecular formula C15H20F3NO3S2 and a molecular weight of 383.46 g/mol. Its IUPAC name is 4-methoxy-N-[4-(trifluoromethylsulfanyl)cycloheptyl]benzenesulfonamide.
| Compound Name | 4-methoxy-N-[4-(trifluoromethylsulfanyl)cycloheptyl]benzenesulfonamide |
|---|---|
| PubChem CID | 166443339 |
| Molecular Formula | C15H20F3NO3S2 |
| Molecular Weight | 383.46 g/mol |
| Exact Mass | 383.08 |
| IUPAC Name | 4-methoxy-N-[4-(trifluoromethylsulfanyl)cycloheptyl]benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NC2CCCC(SC(F)(F)F)CC2)cc1 |
| InChI | InChI=1S/C15H20F3NO3S2/c1-22-12-6-9-14(10-7-12)24(20,21)19-11-3-2-4-13(8-5-11)23-15(16,17)18/h6-7,9-11,13,19H,2-5,8H2,1H3 |
| InChIKey | IHCNJFDWYCOYBI-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.46 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |