C19H23NO5S — CID 10199598
N-[4-(2,4-dihydroxyphenyl)cyclohexyl]-4-methoxybenzenesulfonamide (PubChem CID 10199598) has the molecular formula C19H23NO5S and a molecular weight of 377.46 g/mol. Its IUPAC name is N-[4-(2,4-dihydroxyphenyl)cyclohexyl]-4-methoxybenzenesulfonamide.
| Compound Name | N-[4-(2,4-dihydroxyphenyl)cyclohexyl]-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 10199598 |
| Molecular Formula | C19H23NO5S |
| Molecular Weight | 377.46 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | N-[4-(2,4-dihydroxyphenyl)cyclohexyl]-4-methoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NC2CCC(c3ccc(O)cc3O)CC2)cc1 |
| InChI | InChI=1S/C19H23NO5S/c1-25-16-7-9-17(10-8-16)26(23,24)20-14-4-2-13(3-5-14)18-11-6-15(21)12-19(18)22/h6-14,20-22H,2-5H2,1H3 |
| InChIKey | VZTIAOOYYUMCFM-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.46 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |