C12H16O4 — CID 166445400
methyl (1R,4aR,8aR)-1-hydroxy-7-oxo-1,2,3,4,8,8a-hexahydronaphthalene-4a-carboxylate (PubChem CID 166445400) has the molecular formula C12H16O4 and a molecular weight of 224.26 g/mol. Its IUPAC name is methyl (1R,4aR,8aR)-1-hydroxy-7-oxo-1,2,3,4,8,8a-hexahydronaphthalene-4a-carboxylate.
| Compound Name | methyl (1R,4aR,8aR)-1-hydroxy-7-oxo-1,2,3,4,8,8a-hexahydronaphthalene-4a-carboxylate |
|---|---|
| PubChem CID | 166445400 |
| Molecular Formula | C12H16O4 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | methyl (1R,4aR,8aR)-1-hydroxy-7-oxo-1,2,3,4,8,8a-hexahydronaphthalene-4a-carboxylate |
| SMILES | COC(=O)[C@]12C=CC(=O)C[C@H]1[C@H](O)CCC2 |
| InChI | InChI=1S/C12H16O4/c1-16-11(15)12-5-2-3-10(14)9(12)7-8(13)4-6-12/h4,6,9-10,14H,2-3,5,7H2,1H3/t9-,10+,12+/m0/s1 |
| InChIKey | ZHBNPRYADRKAQN-HOSYDEDBSA-N |
| XLogP | 0.84 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |