C15H22O2 — CID 166445408
(3aS,4S,4aS,8bR)-4-hydroxy-2,2,4a-trimethyl-3,3a,4,5,6,8b-hexahydro-1H-cyclopenta[a]inden-7-one (PubChem CID 166445408) has the molecular formula C15H22O2 and a molecular weight of 234.34 g/mol. Its IUPAC name is (3aS,4S,4aS,8bR)-4-hydroxy-2,2,4a-trimethyl-3,3a,4,5,6,8b-hexahydro-1H-cyclopenta[a]inden-7-one.
| Compound Name | (3aS,4S,4aS,8bR)-4-hydroxy-2,2,4a-trimethyl-3,3a,4,5,6,8b-hexahydro-1H-cyclopenta[a]inden-7-one |
|---|---|
| PubChem CID | 166445408 |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | (3aS,4S,4aS,8bR)-4-hydroxy-2,2,4a-trimethyl-3,3a,4,5,6,8b-hexahydro-1H-cyclopenta[a]inden-7-one |
| SMILES | CC1(C)C[C@H]2[C@@H](C1)C1=CC(=O)CC[C@]1(C)[C@H]2O |
| InChI | InChI=1S/C15H22O2/c1-14(2)7-10-11(8-14)13(17)15(3)5-4-9(16)6-12(10)15/h6,10-11,13,17H,4-5,7-8H2,1-3H3/t10-,11+,13+,15+/m1/s1 |
| InChIKey | VZCLJYVGLVACTO-MPXAEWJHSA-N |
| XLogP | 2.71 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |