C18H34N2 — CID 166445853
(1S)-1-(1-adamantyl)-N',N'-di(propan-2-yl)ethane-1,2-diamine (PubChem CID 166445853) has the molecular formula C18H34N2 and a molecular weight of 278.48 g/mol. Its IUPAC name is (1S)-1-(1-adamantyl)-N',N'-di(propan-2-yl)ethane-1,2-diamine.
| Compound Name | (1S)-1-(1-adamantyl)-N',N'-di(propan-2-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 166445853 |
| Molecular Formula | C18H34N2 |
| Molecular Weight | 278.48 g/mol |
| Exact Mass | 278.27 |
| IUPAC Name | (1S)-1-(1-adamantyl)-N',N'-di(propan-2-yl)ethane-1,2-diamine |
| SMILES | CC(C)N(C[C@@H](N)C12CC3CC(CC(C3)C1)C2)C(C)C |
| InChI | InChI=1S/C18H34N2/c1-12(2)20(13(3)4)11-17(19)18-8-14-5-15(9-18)7-16(6-14)10-18/h12-17H,5-11,19H2,1-4H3/t14?,15?,16?,17-,18?/m1/s1 |
| InChIKey | LJAJRARFGGNCKS-AWDGRILASA-N |
| XLogP | 3.65 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.48 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |